| 1 | //! The module contains a [`Grid`] structure. |
| 2 | |
| 3 | use std::{ |
| 4 | borrow::{Borrow, Cow}, |
| 5 | cmp, |
| 6 | collections::BTreeMap, |
| 7 | fmt::{self, Write}, |
| 8 | }; |
| 9 | |
| 10 | use crate::{ |
| 11 | ansi::{ANSIBuf, ANSIFmt}, |
| 12 | colors::Colors, |
| 13 | config::spanned::{Offset, SpannedConfig}, |
| 14 | config::{AlignmentHorizontal, AlignmentVertical, Formatting, Indent, Position, Sides}, |
| 15 | dimension::Dimension, |
| 16 | records::{IntoRecords, Records}, |
| 17 | util::string::{count_lines, get_lines, string_width, string_width_multiline, Lines}, |
| 18 | }; |
| 19 | |
| 20 | /// Grid provides a set of methods for building a text-based table. |
| 21 | #[derive(Debug, Clone)] |
| 22 | pub struct Grid<R, D, G, C> { |
| 23 | records: R, |
| 24 | config: G, |
| 25 | dimension: D, |
| 26 | colors: C, |
| 27 | } |
| 28 | |
| 29 | impl<R, D, G, C> Grid<R, D, G, C> { |
| 30 | /// The new method creates a grid instance with default styles. |
| 31 | pub fn new(records: R, dimension: D, config: G, colors: C) -> Self { |
| 32 | Grid { |
| 33 | records, |
| 34 | config, |
| 35 | dimension, |
| 36 | colors, |
| 37 | } |
| 38 | } |
| 39 | } |
| 40 | |
| 41 | impl<R, D, G, C> Grid<R, D, G, C> { |
| 42 | /// Builds a table. |
| 43 | pub fn build<F>(self, mut f: F) -> fmt::Result |
| 44 | where |
| 45 | R: Records, |
| 46 | <R::Iter as IntoRecords>::Cell: AsRef<str>, |
| 47 | D: Dimension, |
| 48 | C: Colors, |
| 49 | G: Borrow<SpannedConfig>, |
| 50 | F: Write, |
| 51 | { |
| 52 | if self.records.count_columns() == 0 || self.records.hint_count_rows() == Some(0) { |
| 53 | return Ok(()); |
| 54 | } |
| 55 | |
| 56 | let config = self.config.borrow(); |
| 57 | print_grid(&mut f, self.records, config, &self.dimension, &self.colors) |
| 58 | } |
| 59 | |
| 60 | /// Builds a table into string. |
| 61 | /// |
| 62 | /// Notice that it consumes self. |
| 63 | #[allow (clippy::inherent_to_string)] |
| 64 | pub fn to_string(self) -> String |
| 65 | where |
| 66 | R: Records, |
| 67 | <R::Iter as IntoRecords>::Cell: AsRef<str>, |
| 68 | D: Dimension, |
| 69 | G: Borrow<SpannedConfig>, |
| 70 | C: Colors, |
| 71 | { |
| 72 | let mut buf = String::new(); |
| 73 | self.build(&mut buf).expect("It's guaranteed to never happen otherwise it's considered an stdlib error or impl error" ); |
| 74 | buf |
| 75 | } |
| 76 | } |
| 77 | |
| 78 | fn print_grid<F, R, D, C>( |
| 79 | f: &mut F, |
| 80 | records: R, |
| 81 | cfg: &SpannedConfig, |
| 82 | dimension: &D, |
| 83 | colors: &C, |
| 84 | ) -> fmt::Result |
| 85 | where |
| 86 | F: Write, |
| 87 | R: Records, |
| 88 | <R::Iter as IntoRecords>::Cell: AsRef<str>, |
| 89 | D: Dimension, |
| 90 | C: Colors, |
| 91 | { |
| 92 | // spanned version is a bit more complex and 'supposedly' slower, |
| 93 | // because spans are considered to be not a general case we are having 2 versions |
| 94 | let grid_has_spans: bool = cfg.has_column_spans() || cfg.has_row_spans(); |
| 95 | if grid_has_spans { |
| 96 | print_grid_spanned(f, records, cfg, dims:dimension, colors) |
| 97 | } else { |
| 98 | print_grid_general(f, records, cfg, dims:dimension, colors) |
| 99 | } |
| 100 | } |
| 101 | |
| 102 | fn print_grid_general<F, R, D, C>( |
| 103 | f: &mut F, |
| 104 | records: R, |
| 105 | cfg: &SpannedConfig, |
| 106 | dims: &D, |
| 107 | colors: &C, |
| 108 | ) -> fmt::Result |
| 109 | where |
| 110 | F: Write, |
| 111 | R: Records, |
| 112 | <R::Iter as IntoRecords>::Cell: AsRef<str>, |
| 113 | D: Dimension, |
| 114 | C: Colors, |
| 115 | { |
| 116 | let count_columns = records.count_columns(); |
| 117 | |
| 118 | let mut totalw = None; |
| 119 | let totalh = records |
| 120 | .hint_count_rows() |
| 121 | .map(|count_rows| total_height(cfg, dims, count_rows)); |
| 122 | |
| 123 | let mut records_iter = records.iter_rows().into_iter(); |
| 124 | let mut next_columns = records_iter.next(); |
| 125 | |
| 126 | if next_columns.is_none() { |
| 127 | return Ok(()); |
| 128 | } |
| 129 | |
| 130 | if cfg.get_margin().top.size > 0 { |
| 131 | totalw = Some(output_width(cfg, dims, count_columns)); |
| 132 | |
| 133 | print_margin_top(f, cfg, totalw.unwrap())?; |
| 134 | f.write_char(' \n' )?; |
| 135 | } |
| 136 | |
| 137 | let mut row = 0; |
| 138 | let mut line = 0; |
| 139 | let mut is_prev_row_skipped = false; |
| 140 | let mut buf = None; |
| 141 | while let Some(columns) = next_columns { |
| 142 | let columns = columns.into_iter(); |
| 143 | next_columns = records_iter.next(); |
| 144 | let is_last_row = next_columns.is_none(); |
| 145 | |
| 146 | let height = dims.get_height(row); |
| 147 | let count_rows = convert_count_rows(row, is_last_row); |
| 148 | let has_horizontal = cfg.has_horizontal(row, count_rows); |
| 149 | let shape = (count_rows, count_columns); |
| 150 | |
| 151 | if row > 0 && !is_prev_row_skipped && (has_horizontal || height > 0) { |
| 152 | f.write_char(' \n' )?; |
| 153 | } |
| 154 | |
| 155 | if has_horizontal { |
| 156 | print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?; |
| 157 | |
| 158 | line += 1; |
| 159 | |
| 160 | if height > 0 { |
| 161 | f.write_char(' \n' )?; |
| 162 | } |
| 163 | } |
| 164 | |
| 165 | if height == 1 { |
| 166 | print_single_line_columns(f, columns, cfg, colors, dims, row, line, totalh, shape)? |
| 167 | } else if height > 0 { |
| 168 | if buf.is_none() { |
| 169 | buf = Some(Vec::with_capacity(count_columns)); |
| 170 | } |
| 171 | |
| 172 | let buf = buf.as_mut().unwrap(); |
| 173 | print_multiline_columns( |
| 174 | f, columns, cfg, colors, dims, height, row, line, totalh, shape, buf, |
| 175 | )?; |
| 176 | |
| 177 | buf.clear(); |
| 178 | } |
| 179 | |
| 180 | is_prev_row_skipped = height == 0 && !has_horizontal; |
| 181 | line += height; |
| 182 | row += 1; |
| 183 | } |
| 184 | |
| 185 | if cfg.has_horizontal(row, row) { |
| 186 | f.write_char(' \n' )?; |
| 187 | let shape = (row, count_columns); |
| 188 | print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?; |
| 189 | } |
| 190 | |
| 191 | { |
| 192 | let margin = cfg.get_margin(); |
| 193 | if margin.bottom.size > 0 { |
| 194 | let totalw = totalw.unwrap_or_else(|| output_width(cfg, dims, count_columns)); |
| 195 | |
| 196 | f.write_char(' \n' )?; |
| 197 | print_margin_bottom(f, cfg, totalw)?; |
| 198 | } |
| 199 | } |
| 200 | |
| 201 | Ok(()) |
| 202 | } |
| 203 | |
| 204 | fn output_width<D: Dimension>(cfg: &SpannedConfig, d: D, count_columns: usize) -> usize { |
| 205 | let margin: Sides = cfg.get_margin(); |
| 206 | total_width(cfg, &d, count_columns) + margin.left.size + margin.right.size |
| 207 | } |
| 208 | |
| 209 | #[allow (clippy::too_many_arguments)] |
| 210 | fn print_horizontal_line<F: Write, D: Dimension>( |
| 211 | f: &mut F, |
| 212 | cfg: &SpannedConfig, |
| 213 | line: usize, |
| 214 | totalh: Option<usize>, |
| 215 | dimension: &D, |
| 216 | row: usize, |
| 217 | shape: (usize, usize), |
| 218 | ) -> fmt::Result { |
| 219 | print_margin_left(f, cfg, line, height:totalh)?; |
| 220 | print_split_line(f, cfg, dimension, row, shape)?; |
| 221 | print_margin_right(f, cfg, line, height:totalh)?; |
| 222 | Ok(()) |
| 223 | } |
| 224 | |
| 225 | #[allow (clippy::too_many_arguments)] |
| 226 | fn print_multiline_columns<'a, F, I, D, C>( |
| 227 | f: &mut F, |
| 228 | columns: I, |
| 229 | cfg: &'a SpannedConfig, |
| 230 | colors: &'a C, |
| 231 | dimension: &D, |
| 232 | height: usize, |
| 233 | row: usize, |
| 234 | line: usize, |
| 235 | totalh: Option<usize>, |
| 236 | shape: (usize, usize), |
| 237 | buf: &mut Vec<Cell<I::Item, &'a C::Color>>, |
| 238 | ) -> fmt::Result |
| 239 | where |
| 240 | F: Write, |
| 241 | I: Iterator, |
| 242 | I::Item: AsRef<str>, |
| 243 | D: Dimension, |
| 244 | C: Colors, |
| 245 | { |
| 246 | collect_columns(buf, iter:columns, cfg, colors, dimension, height, row); |
| 247 | print_columns_lines(f, buf, height, cfg, line, row, totalh, shape)?; |
| 248 | Ok(()) |
| 249 | } |
| 250 | |
| 251 | #[allow (clippy::too_many_arguments)] |
| 252 | fn print_single_line_columns<F, I, D, C>( |
| 253 | f: &mut F, |
| 254 | columns: I, |
| 255 | cfg: &SpannedConfig, |
| 256 | colors: &C, |
| 257 | dims: &D, |
| 258 | row: usize, |
| 259 | line: usize, |
| 260 | totalh: Option<usize>, |
| 261 | shape: (usize, usize), |
| 262 | ) -> fmt::Result |
| 263 | where |
| 264 | F: Write, |
| 265 | I: Iterator, |
| 266 | I::Item: AsRef<str>, |
| 267 | D: Dimension, |
| 268 | C: Colors, |
| 269 | { |
| 270 | print_margin_left(f, cfg, line, height:totalh)?; |
| 271 | |
| 272 | for (col: usize, cell) in columns.enumerate() { |
| 273 | let pos: (usize, usize) = (row, col); |
| 274 | let width: usize = dims.get_width(column:col); |
| 275 | let color = colors.get_color(pos); |
| 276 | print_vertical_char(f, cfg, pos, line:0, count_lines:1, count_columns:shape.1)?; |
| 277 | print_single_line_column(f, text:cell.as_ref(), cfg, width, color, pos)?; |
| 278 | } |
| 279 | |
| 280 | print_vertical_char(f, cfg, (row, shape.1), line:0, count_lines:1, count_columns:shape.1)?; |
| 281 | |
| 282 | print_margin_right(f, cfg, line, height:totalh)?; |
| 283 | |
| 284 | Ok(()) |
| 285 | } |
| 286 | |
| 287 | fn print_single_line_column<F: Write, C: ANSIFmt>( |
| 288 | f: &mut F, |
| 289 | text: &str, |
| 290 | cfg: &SpannedConfig, |
| 291 | width: usize, |
| 292 | color: Option<&C>, |
| 293 | pos: Position, |
| 294 | ) -> fmt::Result { |
| 295 | let pos = pos.into(); |
| 296 | let pad = cfg.get_padding(pos); |
| 297 | let pad_color = cfg.get_padding_color(pos); |
| 298 | let fmt = cfg.get_formatting(pos); |
| 299 | let space = cfg.get_justification(pos); |
| 300 | let space_color = cfg.get_justification_color(pos); |
| 301 | |
| 302 | let (text, text_width) = if fmt.horizontal_trim && !text.is_empty() { |
| 303 | let text = string_trim(text); |
| 304 | let width = string_width(&text); |
| 305 | |
| 306 | (text, width) |
| 307 | } else { |
| 308 | let text = Cow::Borrowed(text); |
| 309 | let width = string_width_multiline(&text); |
| 310 | |
| 311 | (text, width) |
| 312 | }; |
| 313 | |
| 314 | let alignment = *cfg.get_alignment_horizontal(pos); |
| 315 | let available_width = width - pad.left.size - pad.right.size; |
| 316 | let (left, right) = calculate_indent(alignment, text_width, available_width); |
| 317 | |
| 318 | print_padding(f, &pad.left, pad_color.left.as_ref())?; |
| 319 | |
| 320 | print_indent(f, space, left, space_color)?; |
| 321 | print_text(f, &text, color)?; |
| 322 | print_indent(f, space, right, space_color)?; |
| 323 | |
| 324 | print_padding(f, &pad.right, pad_color.right.as_ref())?; |
| 325 | |
| 326 | Ok(()) |
| 327 | } |
| 328 | |
| 329 | #[allow (clippy::too_many_arguments)] |
| 330 | fn print_columns_lines<T, F: Write, C: ANSIFmt>( |
| 331 | f: &mut F, |
| 332 | buf: &mut [Cell<T, C>], |
| 333 | height: usize, |
| 334 | cfg: &SpannedConfig, |
| 335 | line: usize, |
| 336 | row: usize, |
| 337 | totalh: Option<usize>, |
| 338 | shape: (usize, usize), |
| 339 | ) -> fmt::Result { |
| 340 | for i: usize in 0..height { |
| 341 | let exact_line: usize = line + i; |
| 342 | |
| 343 | print_margin_left(f, cfg, exact_line, height:totalh)?; |
| 344 | |
| 345 | for (col: usize, cell) in buf.iter_mut().enumerate() { |
| 346 | print_vertical_char(f, cfg, (row, col), line:i, count_lines:height, count_columns:shape.1)?; |
| 347 | cell.display(f)?; |
| 348 | } |
| 349 | |
| 350 | print_vertical_char(f, cfg, (row, shape.1), line:i, count_lines:height, count_columns:shape.1)?; |
| 351 | |
| 352 | print_margin_right(f, cfg, exact_line, height:totalh)?; |
| 353 | |
| 354 | if i + 1 != height { |
| 355 | f.write_char(' \n' )?; |
| 356 | } |
| 357 | } |
| 358 | |
| 359 | Ok(()) |
| 360 | } |
| 361 | |
| 362 | fn collect_columns<'a, I, D, C>( |
| 363 | buf: &mut Vec<Cell<I::Item, &'a C::Color>>, |
| 364 | iter: I, |
| 365 | cfg: &SpannedConfig, |
| 366 | colors: &'a C, |
| 367 | dimension: &D, |
| 368 | height: usize, |
| 369 | row: usize, |
| 370 | ) where |
| 371 | I: Iterator, |
| 372 | I::Item: AsRef<str>, |
| 373 | C: Colors, |
| 374 | D: Dimension, |
| 375 | { |
| 376 | let iter = iter.enumerate().map(|(col: usize, cell)| { |
| 377 | let pos: (usize, usize) = (row, col); |
| 378 | let width: usize = dimension.get_width(column:col); |
| 379 | let color = colors.get_color(pos); |
| 380 | Cell::new(text:cell, width, height, cfg, color, pos) |
| 381 | }); |
| 382 | |
| 383 | buf.extend(iter); |
| 384 | } |
| 385 | |
| 386 | fn print_split_line<F: Write, D: Dimension>( |
| 387 | f: &mut F, |
| 388 | cfg: &SpannedConfig, |
| 389 | dimension: &D, |
| 390 | row: usize, |
| 391 | shape: (usize, usize), |
| 392 | ) -> fmt::Result { |
| 393 | let mut used_color = None; |
| 394 | print_vertical_intersection(f, cfg, (row, 0), shape, &mut used_color)?; |
| 395 | |
| 396 | for col in 0..shape.1 { |
| 397 | let width = dimension.get_width(col); |
| 398 | |
| 399 | // general case |
| 400 | if width > 0 { |
| 401 | let pos = (row, col); |
| 402 | let main = cfg.get_horizontal(pos, shape.0); |
| 403 | match main { |
| 404 | Some(c) => { |
| 405 | let clr = cfg.get_horizontal_color(pos, shape.0); |
| 406 | prepare_coloring(f, clr, &mut used_color)?; |
| 407 | print_horizontal_border(f, cfg, pos, width, c, &used_color)?; |
| 408 | } |
| 409 | None => repeat_char(f, ' ' , width)?, |
| 410 | } |
| 411 | } |
| 412 | |
| 413 | print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?; |
| 414 | } |
| 415 | |
| 416 | if let Some(clr) = used_color.take() { |
| 417 | clr.fmt_ansi_suffix(f)?; |
| 418 | } |
| 419 | |
| 420 | Ok(()) |
| 421 | } |
| 422 | |
| 423 | fn print_grid_spanned<F, R, D, C>( |
| 424 | f: &mut F, |
| 425 | records: R, |
| 426 | cfg: &SpannedConfig, |
| 427 | dims: &D, |
| 428 | colors: &C, |
| 429 | ) -> fmt::Result |
| 430 | where |
| 431 | F: Write, |
| 432 | R: Records, |
| 433 | <R::Iter as IntoRecords>::Cell: AsRef<str>, |
| 434 | D: Dimension, |
| 435 | C: Colors, |
| 436 | { |
| 437 | let count_columns = records.count_columns(); |
| 438 | |
| 439 | let total_width = total_width(cfg, dims, count_columns); |
| 440 | let margin = cfg.get_margin(); |
| 441 | let total_width_with_margin = total_width + margin.left.size + margin.right.size; |
| 442 | |
| 443 | let totalh = records |
| 444 | .hint_count_rows() |
| 445 | .map(|rows| total_height(cfg, dims, rows)); |
| 446 | |
| 447 | if margin.top.size > 0 { |
| 448 | print_margin_top(f, cfg, total_width_with_margin)?; |
| 449 | f.write_char(' \n' )?; |
| 450 | } |
| 451 | |
| 452 | let mut buf = BTreeMap::new(); |
| 453 | |
| 454 | let mut records_iter = records.iter_rows().into_iter(); |
| 455 | let mut next_columns = records_iter.next(); |
| 456 | |
| 457 | let mut need_new_line = false; |
| 458 | let mut line = 0; |
| 459 | let mut row = 0; |
| 460 | while let Some(columns) = next_columns { |
| 461 | let columns = columns.into_iter(); |
| 462 | next_columns = records_iter.next(); |
| 463 | let is_last_row = next_columns.is_none(); |
| 464 | |
| 465 | let height = dims.get_height(row); |
| 466 | let count_rows = convert_count_rows(row, is_last_row); |
| 467 | let shape = (count_rows, count_columns); |
| 468 | |
| 469 | let has_horizontal = cfg.has_horizontal(row, count_rows); |
| 470 | if need_new_line && (has_horizontal || height > 0) { |
| 471 | f.write_char(' \n' )?; |
| 472 | need_new_line = false; |
| 473 | } |
| 474 | |
| 475 | if has_horizontal { |
| 476 | print_margin_left(f, cfg, line, totalh)?; |
| 477 | print_split_line_spanned(f, &mut buf, cfg, dims, row, shape)?; |
| 478 | print_margin_right(f, cfg, line, totalh)?; |
| 479 | |
| 480 | line += 1; |
| 481 | |
| 482 | if height > 0 { |
| 483 | f.write_char(' \n' )?; |
| 484 | } |
| 485 | } |
| 486 | |
| 487 | print_spanned_columns( |
| 488 | f, &mut buf, columns, cfg, colors, dims, height, row, line, totalh, shape, |
| 489 | )?; |
| 490 | |
| 491 | if has_horizontal || height > 0 { |
| 492 | need_new_line = true; |
| 493 | } |
| 494 | |
| 495 | line += height; |
| 496 | row += 1; |
| 497 | } |
| 498 | |
| 499 | if row > 0 { |
| 500 | if cfg.has_horizontal(row, row) { |
| 501 | f.write_char(' \n' )?; |
| 502 | let shape = (row, count_columns); |
| 503 | print_horizontal_line(f, cfg, line, totalh, dims, row, shape)?; |
| 504 | } |
| 505 | |
| 506 | if margin.bottom.size > 0 { |
| 507 | f.write_char(' \n' )?; |
| 508 | print_margin_bottom(f, cfg, total_width_with_margin)?; |
| 509 | } |
| 510 | } |
| 511 | |
| 512 | Ok(()) |
| 513 | } |
| 514 | |
| 515 | fn print_split_line_spanned<S, F: Write, D: Dimension, C: ANSIFmt>( |
| 516 | f: &mut F, |
| 517 | buf: &mut BTreeMap<usize, (Cell<S, C>, usize, usize)>, |
| 518 | cfg: &SpannedConfig, |
| 519 | dimension: &D, |
| 520 | row: usize, |
| 521 | shape: (usize, usize), |
| 522 | ) -> fmt::Result { |
| 523 | let mut used_color = None; |
| 524 | print_vertical_intersection(f, cfg, (row, 0), shape, &mut used_color)?; |
| 525 | |
| 526 | for col in 0..shape.1 { |
| 527 | let pos = (row, col); |
| 528 | if cfg.is_cell_covered_by_both_spans(pos) { |
| 529 | continue; |
| 530 | } |
| 531 | |
| 532 | let width = dimension.get_width(col); |
| 533 | let mut col = col; |
| 534 | if cfg.is_cell_covered_by_row_span(pos) { |
| 535 | // means it's part of other a spanned cell |
| 536 | // so. we just need to use line from other cell. |
| 537 | |
| 538 | let (cell, _, _) = buf.get_mut(&col).unwrap(); |
| 539 | cell.display(f)?; |
| 540 | |
| 541 | // We need to use a correct right split char. |
| 542 | let original_row = closest_visible_row(cfg, pos).unwrap(); |
| 543 | if let Some(span) = cfg.get_column_span((original_row, col)) { |
| 544 | col += span - 1; |
| 545 | } |
| 546 | } else if width > 0 { |
| 547 | // general case |
| 548 | let main = cfg.get_horizontal(pos, shape.0); |
| 549 | match main { |
| 550 | Some(c) => { |
| 551 | let clr = cfg.get_horizontal_color(pos, shape.0); |
| 552 | prepare_coloring(f, clr, &mut used_color)?; |
| 553 | print_horizontal_border(f, cfg, pos, width, c, &used_color)?; |
| 554 | } |
| 555 | None => repeat_char(f, ' ' , width)?, |
| 556 | } |
| 557 | } |
| 558 | |
| 559 | print_vertical_intersection(f, cfg, (row, col + 1), shape, &mut used_color)?; |
| 560 | } |
| 561 | |
| 562 | if let Some(clr) = used_color.take() { |
| 563 | clr.fmt_ansi_suffix(f)?; |
| 564 | } |
| 565 | |
| 566 | Ok(()) |
| 567 | } |
| 568 | |
| 569 | fn print_vertical_intersection<'a, F: fmt::Write>( |
| 570 | f: &mut F, |
| 571 | cfg: &'a SpannedConfig, |
| 572 | pos: Position, |
| 573 | shape: (usize, usize), |
| 574 | used_color: &mut Option<&'a ANSIBuf>, |
| 575 | ) -> fmt::Result { |
| 576 | if !cfg.has_vertical(col:pos.1, count_columns:shape.1) { |
| 577 | return Ok(()); |
| 578 | } |
| 579 | |
| 580 | match cfg.get_intersection(pos, shape) { |
| 581 | Some(c) => { |
| 582 | let clr = cfg.get_intersection_color(pos, shape); |
| 583 | prepare_coloring(f, clr, used_color)?; |
| 584 | f.write_char(c) |
| 585 | } |
| 586 | None => Ok(()), |
| 587 | } |
| 588 | } |
| 589 | |
| 590 | #[allow (clippy::too_many_arguments, clippy::type_complexity)] |
| 591 | fn print_spanned_columns<'a, F, I, D, C>( |
| 592 | f: &mut F, |
| 593 | buf: &mut BTreeMap<usize, (Cell<I::Item, &'a C::Color>, usize, usize)>, |
| 594 | iter: I, |
| 595 | cfg: &SpannedConfig, |
| 596 | colors: &'a C, |
| 597 | dimension: &D, |
| 598 | this_height: usize, |
| 599 | row: usize, |
| 600 | line: usize, |
| 601 | totalh: Option<usize>, |
| 602 | shape: (usize, usize), |
| 603 | ) -> fmt::Result |
| 604 | where |
| 605 | F: Write, |
| 606 | I: Iterator, |
| 607 | I::Item: AsRef<str>, |
| 608 | D: Dimension, |
| 609 | C: Colors, |
| 610 | { |
| 611 | if this_height == 0 { |
| 612 | // it's possible that we dont show row but it contains an actual cell which will be |
| 613 | // rendered after all cause it's a rowspanned |
| 614 | |
| 615 | let mut skip = 0; |
| 616 | for (col, cell) in iter.enumerate() { |
| 617 | if skip > 0 { |
| 618 | skip -= 1; |
| 619 | continue; |
| 620 | } |
| 621 | |
| 622 | if let Some((_, _, colspan)) = buf.get(&col) { |
| 623 | skip = *colspan - 1; |
| 624 | continue; |
| 625 | } |
| 626 | |
| 627 | let pos = (row, col); |
| 628 | let rowspan = cfg.get_row_span(pos).unwrap_or(1); |
| 629 | if rowspan < 2 { |
| 630 | continue; |
| 631 | } |
| 632 | |
| 633 | let height = if rowspan > 1 { |
| 634 | range_height(cfg, dimension, row, row + rowspan, shape.0) |
| 635 | } else { |
| 636 | this_height |
| 637 | }; |
| 638 | |
| 639 | let colspan = cfg.get_column_span(pos).unwrap_or(1); |
| 640 | skip = colspan - 1; |
| 641 | let width = if colspan > 1 { |
| 642 | range_width(cfg, dimension, col, col + colspan, shape.1) |
| 643 | } else { |
| 644 | dimension.get_width(col) |
| 645 | }; |
| 646 | |
| 647 | let color = colors.get_color(pos); |
| 648 | let cell = Cell::new(cell, width, height, cfg, color, pos); |
| 649 | |
| 650 | buf.insert(col, (cell, rowspan, colspan)); |
| 651 | } |
| 652 | |
| 653 | buf.retain(|_, (_, rowspan, _)| { |
| 654 | *rowspan -= 1; |
| 655 | *rowspan != 0 |
| 656 | }); |
| 657 | |
| 658 | return Ok(()); |
| 659 | } |
| 660 | |
| 661 | let mut skip = 0; |
| 662 | for (col, cell) in iter.enumerate() { |
| 663 | if skip > 0 { |
| 664 | skip -= 1; |
| 665 | continue; |
| 666 | } |
| 667 | |
| 668 | if let Some((_, _, colspan)) = buf.get(&col) { |
| 669 | skip = *colspan - 1; |
| 670 | continue; |
| 671 | } |
| 672 | |
| 673 | let pos = (row, col); |
| 674 | let colspan = cfg.get_column_span(pos).unwrap_or(1); |
| 675 | skip = colspan - 1; |
| 676 | |
| 677 | let width = if colspan > 1 { |
| 678 | range_width(cfg, dimension, col, col + colspan, shape.1) |
| 679 | } else { |
| 680 | dimension.get_width(col) |
| 681 | }; |
| 682 | |
| 683 | let rowspan = cfg.get_row_span(pos).unwrap_or(1); |
| 684 | let height = if rowspan > 1 { |
| 685 | range_height(cfg, dimension, row, row + rowspan, shape.0) |
| 686 | } else { |
| 687 | this_height |
| 688 | }; |
| 689 | |
| 690 | let color = colors.get_color(pos); |
| 691 | let cell = Cell::new(cell, width, height, cfg, color, pos); |
| 692 | |
| 693 | buf.insert(col, (cell, rowspan, colspan)); |
| 694 | } |
| 695 | |
| 696 | for i in 0..this_height { |
| 697 | let exact_line = line + i; |
| 698 | let cell_line = i; |
| 699 | |
| 700 | print_margin_left(f, cfg, exact_line, totalh)?; |
| 701 | |
| 702 | for (&col, (cell, _, _)) in buf.iter_mut() { |
| 703 | print_vertical_char(f, cfg, (row, col), cell_line, this_height, shape.1)?; |
| 704 | cell.display(f)?; |
| 705 | } |
| 706 | |
| 707 | print_vertical_char(f, cfg, (row, shape.1), cell_line, this_height, shape.1)?; |
| 708 | |
| 709 | print_margin_right(f, cfg, exact_line, totalh)?; |
| 710 | |
| 711 | if i + 1 != this_height { |
| 712 | f.write_char(' \n' )?; |
| 713 | } |
| 714 | } |
| 715 | |
| 716 | buf.retain(|_, (_, rowspan, _)| { |
| 717 | *rowspan -= 1; |
| 718 | *rowspan != 0 |
| 719 | }); |
| 720 | |
| 721 | Ok(()) |
| 722 | } |
| 723 | |
| 724 | fn print_horizontal_border<F: Write>( |
| 725 | f: &mut F, |
| 726 | cfg: &SpannedConfig, |
| 727 | pos: Position, |
| 728 | width: usize, |
| 729 | c: char, |
| 730 | used_color: &Option<&ANSIBuf>, |
| 731 | ) -> fmt::Result { |
| 732 | if !cfg.is_overridden_horizontal(pos) { |
| 733 | return repeat_char(f, c, width); |
| 734 | } |
| 735 | |
| 736 | for i in 0..width { |
| 737 | let c = cfg.lookup_horizontal_char(pos, i, width).unwrap_or(c); |
| 738 | match cfg.lookup_horizontal_color(pos, i, width) { |
| 739 | Some(color) => match used_color { |
| 740 | Some(clr) => { |
| 741 | clr.fmt_ansi_suffix(f)?; |
| 742 | color.fmt_ansi_prefix(f)?; |
| 743 | f.write_char(c)?; |
| 744 | color.fmt_ansi_suffix(f)?; |
| 745 | clr.fmt_ansi_prefix(f)?; |
| 746 | } |
| 747 | None => { |
| 748 | color.fmt_ansi_prefix(f)?; |
| 749 | f.write_char(c)?; |
| 750 | color.fmt_ansi_suffix(f)?; |
| 751 | } |
| 752 | }, |
| 753 | _ => f.write_char(c)?, |
| 754 | } |
| 755 | } |
| 756 | |
| 757 | Ok(()) |
| 758 | } |
| 759 | |
| 760 | struct Cell<T, C> { |
| 761 | lines: LinesIter<T>, |
| 762 | width: usize, |
| 763 | indent_top: usize, |
| 764 | indent_left: Option<usize>, |
| 765 | alignh: AlignmentHorizontal, |
| 766 | fmt: Formatting, |
| 767 | pad: Sides<Indent>, |
| 768 | pad_color: Sides<Option<ANSIBuf>>, |
| 769 | color: Option<C>, |
| 770 | justification: (char, Option<ANSIBuf>), |
| 771 | } |
| 772 | |
| 773 | impl<T, C> Cell<T, C> |
| 774 | where |
| 775 | T: AsRef<str>, |
| 776 | { |
| 777 | fn new( |
| 778 | text: T, |
| 779 | width: usize, |
| 780 | height: usize, |
| 781 | cfg: &SpannedConfig, |
| 782 | color: Option<C>, |
| 783 | pos: Position, |
| 784 | ) -> Cell<T, C> { |
| 785 | let fmt = *cfg.get_formatting(pos.into()); |
| 786 | let pad = cfg.get_padding(pos.into()); |
| 787 | let pad_color = cfg.get_padding_color(pos.into()).clone(); |
| 788 | let alignh = *cfg.get_alignment_horizontal(pos.into()); |
| 789 | let alignv = *cfg.get_alignment_vertical(pos.into()); |
| 790 | let justification = ( |
| 791 | cfg.get_justification(pos.into()), |
| 792 | cfg.get_justification_color(pos.into()).cloned(), |
| 793 | ); |
| 794 | |
| 795 | let (count_lines, skip) = if fmt.vertical_trim { |
| 796 | let (len, top, _) = count_empty_lines(text.as_ref()); |
| 797 | (len, top) |
| 798 | } else { |
| 799 | (count_lines(text.as_ref()), 0) |
| 800 | }; |
| 801 | |
| 802 | let indent_top = top_indent(&pad, alignv, count_lines, height); |
| 803 | |
| 804 | let mut indent_left = None; |
| 805 | if !fmt.allow_lines_alignment { |
| 806 | let text_width = get_text_width(text.as_ref(), fmt.horizontal_trim); |
| 807 | let available = width - pad.left.size - pad.right.size; |
| 808 | indent_left = Some(calculate_indent(alignh, text_width, available).0); |
| 809 | } |
| 810 | |
| 811 | let mut lines = LinesIter::new(text); |
| 812 | for _ in 0..skip { |
| 813 | let _ = lines.lines.next(); |
| 814 | } |
| 815 | |
| 816 | Self { |
| 817 | lines, |
| 818 | indent_left, |
| 819 | indent_top, |
| 820 | width, |
| 821 | alignh, |
| 822 | fmt, |
| 823 | pad, |
| 824 | pad_color, |
| 825 | color, |
| 826 | justification, |
| 827 | } |
| 828 | } |
| 829 | } |
| 830 | |
| 831 | impl<T, C> Cell<T, C> |
| 832 | where |
| 833 | C: ANSIFmt, |
| 834 | { |
| 835 | fn display<F: Write>(&mut self, f: &mut F) -> fmt::Result { |
| 836 | if self.indent_top > 0 { |
| 837 | self.indent_top -= 1; |
| 838 | print_padding_n(f, &self.pad.top, self.pad_color.top.as_ref(), self.width)?; |
| 839 | return Ok(()); |
| 840 | } |
| 841 | |
| 842 | let line = match self.lines.lines.next() { |
| 843 | Some(line) => line, |
| 844 | None => { |
| 845 | let color = self.pad_color.bottom.as_ref(); |
| 846 | print_padding_n(f, &self.pad.bottom, color, self.width)?; |
| 847 | return Ok(()); |
| 848 | } |
| 849 | }; |
| 850 | |
| 851 | let line = if self.fmt.horizontal_trim && !line.is_empty() { |
| 852 | string_trim(&line) |
| 853 | } else { |
| 854 | line |
| 855 | }; |
| 856 | |
| 857 | let line_width = string_width(&line); |
| 858 | let available_width = self.width - self.pad.left.size - self.pad.right.size; |
| 859 | |
| 860 | let (left, right) = if self.fmt.allow_lines_alignment { |
| 861 | calculate_indent(self.alignh, line_width, available_width) |
| 862 | } else { |
| 863 | let left = self.indent_left.expect("must be here" ); |
| 864 | (left, available_width - line_width - left) |
| 865 | }; |
| 866 | |
| 867 | let (justification, justification_color) = |
| 868 | (self.justification.0, self.justification.1.as_ref()); |
| 869 | |
| 870 | print_padding(f, &self.pad.left, self.pad_color.left.as_ref())?; |
| 871 | |
| 872 | print_indent(f, justification, left, justification_color)?; |
| 873 | print_text(f, &line, self.color.as_ref())?; |
| 874 | print_indent(f, justification, right, justification_color)?; |
| 875 | |
| 876 | print_padding(f, &self.pad.right, self.pad_color.right.as_ref())?; |
| 877 | |
| 878 | Ok(()) |
| 879 | } |
| 880 | } |
| 881 | |
| 882 | struct LinesIter<C> { |
| 883 | _cell: C, |
| 884 | /// SAFETY: IT'S NOT SAFE TO KEEP THE 'static REFERENCES AROUND AS THEY ARE NOT 'static in reality AND WILL BE DROPPED |
| 885 | _text: &'static str, |
| 886 | /// SAFETY: IT'S NOT SAFE TO KEEP THE 'static REFERENCES AROUND AS THEY ARE NOT 'static in reality AND WILL BE DROPPED |
| 887 | lines: Lines<'static>, |
| 888 | } |
| 889 | |
| 890 | impl<C> LinesIter<C> { |
| 891 | fn new(cell: C) -> Self |
| 892 | where |
| 893 | C: AsRef<str>, |
| 894 | { |
| 895 | // We want to not allocate a String/Vec. |
| 896 | // It's currently not possible due to a lifetime issues. (It's known as self-referential struct) |
| 897 | // |
| 898 | // Here we change the lifetime of text. |
| 899 | // |
| 900 | // # Safety |
| 901 | // |
| 902 | // It must be safe because the referenced string and the references are dropped at the same time. |
| 903 | // And the referenced String is guaranteed to not be changed. |
| 904 | let text = cell.as_ref(); |
| 905 | let text = unsafe { |
| 906 | std::str::from_utf8_unchecked(std::slice::from_raw_parts(text.as_ptr(), text.len())) |
| 907 | }; |
| 908 | |
| 909 | let lines = get_lines(text); |
| 910 | |
| 911 | Self { |
| 912 | _cell: cell, |
| 913 | _text: text, |
| 914 | lines, |
| 915 | } |
| 916 | } |
| 917 | } |
| 918 | |
| 919 | fn print_text<F: Write>(f: &mut F, text: &str, clr: Option<impl ANSIFmt>) -> fmt::Result { |
| 920 | match clr { |
| 921 | Some(color) => { |
| 922 | color.fmt_ansi_prefix(f)?; |
| 923 | f.write_str(text)?; |
| 924 | color.fmt_ansi_suffix(f) |
| 925 | } |
| 926 | None => f.write_str(text), |
| 927 | } |
| 928 | } |
| 929 | |
| 930 | fn prepare_coloring<'a, F: Write>( |
| 931 | f: &mut F, |
| 932 | clr: Option<&'a ANSIBuf>, |
| 933 | used_color: &mut Option<&'a ANSIBuf>, |
| 934 | ) -> fmt::Result { |
| 935 | match clr { |
| 936 | Some(clr) => match used_color.as_mut() { |
| 937 | Some(used_clr) => { |
| 938 | if **used_clr != *clr { |
| 939 | used_clr.fmt_ansi_suffix(f)?; |
| 940 | clr.fmt_ansi_prefix(f)?; |
| 941 | *used_clr = clr; |
| 942 | } |
| 943 | } |
| 944 | None => { |
| 945 | clr.fmt_ansi_prefix(f)?; |
| 946 | *used_color = Some(clr); |
| 947 | } |
| 948 | }, |
| 949 | None => { |
| 950 | if let Some(clr) = used_color.take() { |
| 951 | clr.fmt_ansi_suffix(f)? |
| 952 | } |
| 953 | } |
| 954 | } |
| 955 | |
| 956 | Ok(()) |
| 957 | } |
| 958 | |
| 959 | fn top_indent( |
| 960 | padding: &Sides<Indent>, |
| 961 | alignment: AlignmentVertical, |
| 962 | cell_height: usize, |
| 963 | available: usize, |
| 964 | ) -> usize { |
| 965 | let height: usize = available - padding.top.size; |
| 966 | let indent: usize = indent_from_top(alignment, available:height, real:cell_height); |
| 967 | |
| 968 | indent + padding.top.size |
| 969 | } |
| 970 | |
| 971 | fn indent_from_top(alignment: AlignmentVertical, available: usize, real: usize) -> usize { |
| 972 | match alignment { |
| 973 | AlignmentVertical::Top => 0, |
| 974 | AlignmentVertical::Bottom => available - real, |
| 975 | AlignmentVertical::Center => (available - real) / 2, |
| 976 | } |
| 977 | } |
| 978 | |
| 979 | fn calculate_indent( |
| 980 | alignment: AlignmentHorizontal, |
| 981 | text_width: usize, |
| 982 | available: usize, |
| 983 | ) -> (usize, usize) { |
| 984 | let diff: usize = available - text_width; |
| 985 | match alignment { |
| 986 | AlignmentHorizontal::Left => (0, diff), |
| 987 | AlignmentHorizontal::Right => (diff, 0), |
| 988 | AlignmentHorizontal::Center => { |
| 989 | let left: usize = diff / 2; |
| 990 | let rest: usize = diff - left; |
| 991 | (left, rest) |
| 992 | } |
| 993 | } |
| 994 | } |
| 995 | |
| 996 | fn repeat_char<F: Write>(f: &mut F, c: char, n: usize) -> fmt::Result { |
| 997 | for _ in 0..n { |
| 998 | f.write_char(c)?; |
| 999 | } |
| 1000 | |
| 1001 | Ok(()) |
| 1002 | } |
| 1003 | |
| 1004 | fn print_vertical_char<F: Write>( |
| 1005 | f: &mut F, |
| 1006 | cfg: &SpannedConfig, |
| 1007 | pos: Position, |
| 1008 | line: usize, |
| 1009 | count_lines: usize, |
| 1010 | count_columns: usize, |
| 1011 | ) -> fmt::Result { |
| 1012 | let symbol = match cfg.get_vertical(pos, count_columns) { |
| 1013 | Some(c) => c, |
| 1014 | None => return Ok(()), |
| 1015 | }; |
| 1016 | |
| 1017 | let symbol = cfg |
| 1018 | .lookup_vertical_char(pos, line, count_lines) |
| 1019 | .unwrap_or(symbol); |
| 1020 | |
| 1021 | let color = cfg |
| 1022 | .get_vertical_color(pos, count_columns) |
| 1023 | .or_else(|| cfg.lookup_vertical_color(pos, line, count_lines)); |
| 1024 | |
| 1025 | match color { |
| 1026 | Some(clr) => { |
| 1027 | clr.fmt_ansi_prefix(f)?; |
| 1028 | f.write_char(symbol)?; |
| 1029 | clr.fmt_ansi_suffix(f)?; |
| 1030 | } |
| 1031 | None => f.write_char(symbol)?, |
| 1032 | } |
| 1033 | |
| 1034 | Ok(()) |
| 1035 | } |
| 1036 | |
| 1037 | fn print_margin_top<F: Write>(f: &mut F, cfg: &SpannedConfig, width: usize) -> fmt::Result { |
| 1038 | let indent: Indent = cfg.get_margin().top; |
| 1039 | let offset: Offset = cfg.get_margin_offset().top; |
| 1040 | let color: Sides<{unknown}> = cfg.get_margin_color(); |
| 1041 | let color = color.top.as_ref(); |
| 1042 | print_indent_lines(f, &indent, &offset, color, width) |
| 1043 | } |
| 1044 | |
| 1045 | fn print_margin_bottom<F: Write>(f: &mut F, cfg: &SpannedConfig, width: usize) -> fmt::Result { |
| 1046 | let indent: Indent = cfg.get_margin().bottom; |
| 1047 | let offset: Offset = cfg.get_margin_offset().bottom; |
| 1048 | let color: Sides<{unknown}> = cfg.get_margin_color(); |
| 1049 | let color = color.bottom.as_ref(); |
| 1050 | print_indent_lines(f, &indent, &offset, color, width) |
| 1051 | } |
| 1052 | |
| 1053 | fn print_margin_left<F: Write>( |
| 1054 | f: &mut F, |
| 1055 | cfg: &SpannedConfig, |
| 1056 | line: usize, |
| 1057 | height: Option<usize>, |
| 1058 | ) -> fmt::Result { |
| 1059 | let indent: Indent = cfg.get_margin().left; |
| 1060 | let offset: Offset = cfg.get_margin_offset().left; |
| 1061 | let color: Sides<{unknown}> = cfg.get_margin_color(); |
| 1062 | let color = color.left.as_ref(); |
| 1063 | print_margin_vertical(f, indent, offset, color, line, height) |
| 1064 | } |
| 1065 | |
| 1066 | fn print_margin_right<F: Write>( |
| 1067 | f: &mut F, |
| 1068 | cfg: &SpannedConfig, |
| 1069 | line: usize, |
| 1070 | height: Option<usize>, |
| 1071 | ) -> fmt::Result { |
| 1072 | let indent: Indent = cfg.get_margin().right; |
| 1073 | let offset: Offset = cfg.get_margin_offset().right; |
| 1074 | let color: Sides<{unknown}> = cfg.get_margin_color(); |
| 1075 | let color = color.right.as_ref(); |
| 1076 | print_margin_vertical(f, indent, offset, color, line, height) |
| 1077 | } |
| 1078 | |
| 1079 | fn print_margin_vertical<F: Write>( |
| 1080 | f: &mut F, |
| 1081 | indent: Indent, |
| 1082 | offset: Offset, |
| 1083 | color: Option<&ANSIBuf>, |
| 1084 | line: usize, |
| 1085 | height: Option<usize>, |
| 1086 | ) -> fmt::Result { |
| 1087 | if indent.size == 0 { |
| 1088 | return Ok(()); |
| 1089 | } |
| 1090 | |
| 1091 | match offset { |
| 1092 | Offset::Begin(mut offset) => { |
| 1093 | if let Some(max) = height { |
| 1094 | offset = cmp::min(offset, max); |
| 1095 | } |
| 1096 | |
| 1097 | if line >= offset { |
| 1098 | print_indent(f, indent.fill, indent.size, color)?; |
| 1099 | } else { |
| 1100 | repeat_char(f, ' ' , indent.size)?; |
| 1101 | } |
| 1102 | } |
| 1103 | Offset::End(mut offset) => { |
| 1104 | if let Some(max) = height { |
| 1105 | offset = cmp::min(offset, max); |
| 1106 | let pos = max - offset; |
| 1107 | |
| 1108 | if line >= pos { |
| 1109 | repeat_char(f, ' ' , indent.size)?; |
| 1110 | } else { |
| 1111 | print_indent(f, indent.fill, indent.size, color)?; |
| 1112 | } |
| 1113 | } else { |
| 1114 | print_indent(f, indent.fill, indent.size, color)?; |
| 1115 | } |
| 1116 | } |
| 1117 | } |
| 1118 | |
| 1119 | Ok(()) |
| 1120 | } |
| 1121 | |
| 1122 | fn print_indent_lines<F: Write>( |
| 1123 | f: &mut F, |
| 1124 | indent: &Indent, |
| 1125 | offset: &Offset, |
| 1126 | color: Option<&ANSIBuf>, |
| 1127 | width: usize, |
| 1128 | ) -> fmt::Result { |
| 1129 | if indent.size == 0 { |
| 1130 | return Ok(()); |
| 1131 | } |
| 1132 | |
| 1133 | let (start_offset, end_offset) = match offset { |
| 1134 | Offset::Begin(start) => (*start, 0), |
| 1135 | Offset::End(end) => (0, *end), |
| 1136 | }; |
| 1137 | |
| 1138 | let start_offset = std::cmp::min(start_offset, width); |
| 1139 | let end_offset = std::cmp::min(end_offset, width); |
| 1140 | let indent_size = width - start_offset - end_offset; |
| 1141 | |
| 1142 | for i in 0..indent.size { |
| 1143 | if start_offset > 0 { |
| 1144 | repeat_char(f, ' ' , start_offset)?; |
| 1145 | } |
| 1146 | |
| 1147 | if indent_size > 0 { |
| 1148 | print_indent(f, indent.fill, indent_size, color)?; |
| 1149 | } |
| 1150 | |
| 1151 | if end_offset > 0 { |
| 1152 | repeat_char(f, ' ' , end_offset)?; |
| 1153 | } |
| 1154 | |
| 1155 | if i + 1 != indent.size { |
| 1156 | f.write_char(' \n' )?; |
| 1157 | } |
| 1158 | } |
| 1159 | |
| 1160 | Ok(()) |
| 1161 | } |
| 1162 | |
| 1163 | fn print_padding<F: Write>(f: &mut F, pad: &Indent, color: Option<&ANSIBuf>) -> fmt::Result { |
| 1164 | print_indent(f, c:pad.fill, n:pad.size, color) |
| 1165 | } |
| 1166 | |
| 1167 | fn print_padding_n<F: Write>( |
| 1168 | f: &mut F, |
| 1169 | pad: &Indent, |
| 1170 | color: Option<&ANSIBuf>, |
| 1171 | n: usize, |
| 1172 | ) -> fmt::Result { |
| 1173 | print_indent(f, c:pad.fill, n, color) |
| 1174 | } |
| 1175 | |
| 1176 | fn print_indent<F: Write>(f: &mut F, c: char, n: usize, color: Option<&ANSIBuf>) -> fmt::Result { |
| 1177 | if n == 0 { |
| 1178 | return Ok(()); |
| 1179 | } |
| 1180 | |
| 1181 | match color { |
| 1182 | Some(color) => { |
| 1183 | color.fmt_ansi_prefix(f)?; |
| 1184 | repeat_char(f, c, n)?; |
| 1185 | color.fmt_ansi_suffix(f) |
| 1186 | } |
| 1187 | None => repeat_char(f, c, n), |
| 1188 | } |
| 1189 | } |
| 1190 | |
| 1191 | fn range_width<D>(cfg: &SpannedConfig, dims: D, start: usize, end: usize, max: usize) -> usize |
| 1192 | where |
| 1193 | D: Dimension, |
| 1194 | { |
| 1195 | let count_borders: usize = count_verticals_in_range(cfg, start, end, max); |
| 1196 | let range_width = (start..end).map(|col: usize| dims.get_width(column:col)).sum::<usize>(); |
| 1197 | |
| 1198 | count_borders + range_width |
| 1199 | } |
| 1200 | |
| 1201 | fn range_height<D>(cfg: &SpannedConfig, dims: D, from: usize, end: usize, max: usize) -> usize |
| 1202 | where |
| 1203 | D: Dimension, |
| 1204 | { |
| 1205 | let count_borders: usize = count_horizontals_in_range(cfg, from, end, max); |
| 1206 | let range_width = (from..end).map(|col: usize| dims.get_height(row:col)).sum::<usize>(); |
| 1207 | |
| 1208 | count_borders + range_width |
| 1209 | } |
| 1210 | |
| 1211 | fn count_horizontals_in_range(cfg: &SpannedConfig, from: usize, end: usize, max: usize) -> usize { |
| 1212 | (from + 1..end) |
| 1213 | .map(|i: usize| cfg.has_horizontal(row:i, count_rows:max) as usize) |
| 1214 | .sum() |
| 1215 | } |
| 1216 | |
| 1217 | fn count_verticals_in_range(cfg: &SpannedConfig, start: usize, end: usize, max: usize) -> usize { |
| 1218 | (start..end) |
| 1219 | .skip(1) |
| 1220 | .map(|i: usize| cfg.has_vertical(col:i, count_columns:max) as usize) |
| 1221 | .sum() |
| 1222 | } |
| 1223 | |
| 1224 | fn closest_visible_row(cfg: &SpannedConfig, mut pos: Position) -> Option<usize> { |
| 1225 | loop { |
| 1226 | if cfg.is_cell_visible(pos) { |
| 1227 | return Some(pos.0); |
| 1228 | } |
| 1229 | |
| 1230 | if pos.0 == 0 { |
| 1231 | return None; |
| 1232 | } |
| 1233 | |
| 1234 | pos.0 -= 1; |
| 1235 | } |
| 1236 | } |
| 1237 | |
| 1238 | fn convert_count_rows(row: usize, is_last: bool) -> usize { |
| 1239 | if is_last { |
| 1240 | row + 1 |
| 1241 | } else { |
| 1242 | row + 2 |
| 1243 | } |
| 1244 | } |
| 1245 | |
| 1246 | /// Trims a string. |
| 1247 | fn string_trim(text: &str) -> Cow<'_, str> { |
| 1248 | #[cfg (feature = "ansi" )] |
| 1249 | { |
| 1250 | ansi_str::AnsiStr::ansi_trim(text) |
| 1251 | } |
| 1252 | |
| 1253 | #[cfg (not(feature = "ansi" ))] |
| 1254 | { |
| 1255 | text.trim().into() |
| 1256 | } |
| 1257 | } |
| 1258 | |
| 1259 | fn total_width<D: Dimension>(cfg: &SpannedConfig, dimension: &D, count_columns: usize) -> usize { |
| 1260 | (0..count_columns) |
| 1261 | .map(|i: usize| dimension.get_width(column:i)) |
| 1262 | .sum::<usize>() |
| 1263 | + cfg.count_vertical(count_columns) |
| 1264 | } |
| 1265 | |
| 1266 | fn total_height<D: Dimension>(cfg: &SpannedConfig, dimension: &D, count_rows: usize) -> usize { |
| 1267 | (0..count_rows) |
| 1268 | .map(|i: usize| dimension.get_height(row:i)) |
| 1269 | .sum::<usize>() |
| 1270 | + cfg.count_horizontal(count_rows) |
| 1271 | } |
| 1272 | |
| 1273 | fn count_empty_lines(cell: &str) -> (usize, usize, usize) { |
| 1274 | let mut len = 0; |
| 1275 | let mut top = 0; |
| 1276 | let mut bottom = 0; |
| 1277 | let mut top_check = true; |
| 1278 | |
| 1279 | for line in get_lines(cell) { |
| 1280 | let is_empty = line.trim().is_empty(); |
| 1281 | if top_check { |
| 1282 | if is_empty { |
| 1283 | top += 1; |
| 1284 | } else { |
| 1285 | len = 1; |
| 1286 | top_check = false; |
| 1287 | } |
| 1288 | |
| 1289 | continue; |
| 1290 | } |
| 1291 | |
| 1292 | if is_empty { |
| 1293 | bottom += 1; |
| 1294 | } else { |
| 1295 | len += bottom + 1; |
| 1296 | bottom = 0; |
| 1297 | } |
| 1298 | } |
| 1299 | |
| 1300 | (len, top, bottom) |
| 1301 | } |
| 1302 | |
| 1303 | fn get_text_width(text: &str, trim: bool) -> usize { |
| 1304 | if trim { |
| 1305 | get_linesLines<'_>(text) |
| 1306 | .map(|line| string_width(text:line.trim())) |
| 1307 | .max() |
| 1308 | .unwrap_or(0) |
| 1309 | } else { |
| 1310 | string_width_multiline(text) |
| 1311 | } |
| 1312 | } |
| 1313 | |
| 1314 | #[cfg (test)] |
| 1315 | mod tests { |
| 1316 | // use crate::util::string_width; |
| 1317 | |
| 1318 | use super::*; |
| 1319 | |
| 1320 | // #[test] |
| 1321 | // fn horizontal_alignment_test() { |
| 1322 | // use std::fmt; |
| 1323 | |
| 1324 | // struct F<'a>(&'a str, AlignmentHorizontal, usize); |
| 1325 | |
| 1326 | // impl fmt::Display for F<'_> { |
| 1327 | // fn fmt(&self, f: &mut impl fmt::Write) -> fmt::Result { |
| 1328 | // let (left, right) = calculate_indent(self.1, string_width(self.0), self.2); |
| 1329 | // print_text_formatted(f, &self.0, 4, Option::<&AnsiColor<'_>>::None) |
| 1330 | // } |
| 1331 | // } |
| 1332 | |
| 1333 | // assert_eq!(F("AAA", AlignmentHorizontal::Right, 4).to_string(), " AAA"); |
| 1334 | // assert_eq!(F("AAA", AlignmentHorizontal::Left, 4).to_string(), "AAA "); |
| 1335 | // assert_eq!(F("AAA", AlignmentHorizontal::Center, 4).to_string(), "AAA "); |
| 1336 | // assert_eq!(F("🎩", AlignmentHorizontal::Center, 4).to_string(), " 🎩 "); |
| 1337 | // assert_eq!(F("🎩", AlignmentHorizontal::Center, 3).to_string(), "🎩 "); |
| 1338 | |
| 1339 | // #[cfg(feature = "ansi")] |
| 1340 | // { |
| 1341 | // use owo_colors::OwoColorize; |
| 1342 | // let text = "Colored Text".red().to_string(); |
| 1343 | // assert_eq!( |
| 1344 | // F(&text, AlignmentHorizontal::Center, 15).to_string(), |
| 1345 | // format!(" {} ", text) |
| 1346 | // ); |
| 1347 | // } |
| 1348 | // } |
| 1349 | |
| 1350 | #[test] |
| 1351 | fn vertical_alignment_test() { |
| 1352 | use AlignmentVertical::*; |
| 1353 | |
| 1354 | assert_eq!(indent_from_top(Bottom, 1, 1), 0); |
| 1355 | assert_eq!(indent_from_top(Top, 1, 1), 0); |
| 1356 | assert_eq!(indent_from_top(Center, 1, 1), 0); |
| 1357 | assert_eq!(indent_from_top(Bottom, 3, 1), 2); |
| 1358 | assert_eq!(indent_from_top(Top, 3, 1), 0); |
| 1359 | assert_eq!(indent_from_top(Center, 3, 1), 1); |
| 1360 | assert_eq!(indent_from_top(Center, 4, 1), 1); |
| 1361 | } |
| 1362 | |
| 1363 | #[test] |
| 1364 | fn count_empty_lines_test() { |
| 1365 | assert_eq!(count_empty_lines(" \n\nsome text \n\n\n" ), (1, 2, 3)); |
| 1366 | assert_eq!(count_empty_lines(" \n\nsome \ntext \n\n\n" ), (2, 2, 3)); |
| 1367 | assert_eq!(count_empty_lines(" \n\nsome \nsome \ntext \n\n\n" ), (3, 2, 3)); |
| 1368 | assert_eq!(count_empty_lines(" \n\n\n\n" ), (0, 5, 0)); |
| 1369 | } |
| 1370 | } |
| 1371 | |